C22H26BrN6O6P — CID 156688319
methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(3-bromophenoxy)phosphoryl]amino]propanoate (PubChem CID 156688319) has the molecular formula C22H26BrN6O6P and a molecular weight of 581.36 g/mol. Its IUPAC name is methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(3-bromophenoxy)phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(3-bromophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156688319 |
| Molecular Formula | C22H26BrN6O6P |
| Molecular Weight | 581.36 g/mol |
| Exact Mass | 580.08 |
| IUPAC Name | methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(3-bromophenoxy)phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@@H]1C=C[C@H](n2cnc3c(OC)nc(N)nc32)C1)Oc1cccc(Br)c1 |
| InChI | InChI=1S/C22H26BrN6O6P/c1-13(21(30)33-3)28-36(31,35-17-6-4-5-15(23)10-17)34-11-14-7-8-16(9-14)29-12-25-18-19(29)26-22(24)27-20(18)32-2/h4-8,10,12-14,16H,9,11H2,1-3H3,(H,28,31)(H2,24,26,27)/t13-,14+,16-,36?/m0/s1 |
| InChIKey | DQJIQWBJSBWWNF-ZOXCSCDKSA-N |
| XLogP | 3.65 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|