C27H34N7O7P — CID 5496379
dimethyl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]pentanedioate (PubChem CID 5496379) has the molecular formula C27H34N7O7P and a molecular weight of 599.59 g/mol. Its IUPAC name is dimethyl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]pentanedioate |
|---|---|
| PubChem CID | 5496379 |
| Molecular Formula | C27H34N7O7P |
| Molecular Weight | 599.59 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | dimethyl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NP(=O)(OC[C@@H]1C=C[C@H](n2cnc3c(NC4CC4)nc(N)nc32)C1)Oc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C27H34N7O7P/c1-38-22(35)13-12-21(26(36)39-2)33-42(37,41-20-6-4-3-5-7-20)40-15-17-8-11-19(14-17)34-16-29-23-24(30-18-9-10-18)31-27(28)32-25(23)34/h3-8,11,16-19,21H,9-10,12-15H2,1-2H3,(H,33,37)(H3,28,30,31,32)/t17-,19+,21+,42?/m1/s1 |
| InChIKey | AJMPJGOKOOASRB-MOIZACIZSA-N |
| XLogP | 3.39 |
| TPSA | 181.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|