C25H30N7O6P — CID 166711688
methyl (2R)-2-[[[(2S,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 166711688) has the molecular formula C25H30N7O6P and a molecular weight of 555.53 g/mol. Its IUPAC name is methyl (2R)-2-[[[(2S,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[[(2S,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166711688 |
| Molecular Formula | C25H30N7O6P |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | methyl (2R)-2-[[[(2S,4R,5R)-5-[2-amino-6-(cyclopropylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@H]1C[C@@H](COP(=O)(N[C@H](C)C(=O)OC)Oc2ccccc2)O[C@H]1n1cnc2c(NC3CC3)nc(N)nc21 |
| InChI | InChI=1S/C25H30N7O6P/c1-4-16-12-19(13-36-39(34,31-15(2)24(33)35-3)38-18-8-6-5-7-9-18)37-23(16)32-14-27-20-21(28-17-10-11-17)29-25(26)30-22(20)32/h1,5-9,14-17,19,23H,10-13H2,2-3H3,(H,31,34)(H3,26,28,29,30)/t15-,16+,19+,23-,39?/m1/s1 |
| InChIKey | WXSZIEDOFABYTM-WBAUQMPFSA-N |
| XLogP | 2.87 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|