C23H28N7O5PS — CID 166711698
methyl (2R)-2-[[[(2S,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 166711698) has the molecular formula C23H28N7O5PS and a molecular weight of 545.56 g/mol. Its IUPAC name is methyl (2R)-2-[[[(2S,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[[(2S,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 166711698 |
| Molecular Formula | C23H28N7O5PS |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | methyl (2R)-2-[[[(2S,4R,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-ethynyloxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | C#C[C@H]1C[C@@H](CO[P@@](=S)(N[C@H](C)C(=O)OC)Oc2ccccc2)O[C@H]1n1cnc2c(NC)nc(N)nc21 |
| InChI | InChI=1S/C23H28N7O5PS/c1-5-15-11-17(34-21(15)30-13-26-18-19(25-3)27-23(24)28-20(18)30)12-33-36(37,29-14(2)22(31)32-4)35-16-9-7-6-8-10-16/h1,6-10,13-15,17,21H,11-12H2,2-4H3,(H,29,37)(H3,24,25,27,28)/t14-,15+,17+,21-,36+/m1/s1 |
| InChIKey | QKHKOWIYJKKBBF-LERKVVMDSA-N |
| XLogP | 2.46 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|