C18H22N6O4P+ — CID 138492411
[(4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium (PubChem CID 138492411) has the molecular formula C18H22N6O4P+ and a molecular weight of 417.39 g/mol. Its IUPAC name is [(4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium.
| Compound Name | [(4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 138492411 |
| Molecular Formula | C18H22N6O4P+ |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [(4S,5R)-5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methoxy-oxo-phenoxyphosphanium |
| SMILES | CNc1nc(N)nc2c1ncn2[C@@H]1OC(CO[P+](=O)Oc2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C18H22N6O4P/c1-11-8-13(9-26-29(25)28-12-6-4-3-5-7-12)27-17(11)24-10-21-14-15(20-2)22-18(19)23-16(14)24/h3-7,10-11,13,17H,8-9H2,1-2H3,(H3,19,20,22,23)/q+1/t11-,13?,17+/m0/s1 |
| InChIKey | OSFBKGOUFCXVKC-PGECJRHESA-N |
| XLogP | 3.13 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|