C17H28N6O4 — CID 156898267
[5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methanol;oxan-2-ol (PubChem CID 156898267) has the molecular formula C17H28N6O4 and a molecular weight of 380.45 g/mol. Its IUPAC name is [5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methanol;oxan-2-ol.
| Compound Name | [5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methanol;oxan-2-ol |
|---|---|
| PubChem CID | 156898267 |
| Molecular Formula | C17H28N6O4 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methanol;oxan-2-ol |
| SMILES | CNc1nc(N)nc2c1ncn2C1OC(CO)CC1C.OC1CCCCO1 |
| InChI | InChI=1S/C12H18N6O2.C5H10O2/c1-6-3-7(4-19)20-11(6)18-5-15-8-9(14-2)16-12(13)17-10(8)18;6-5-3-1-2-4-7-5/h5-7,11,19H,3-4H2,1-2H3,(H3,13,14,16,17);5-6H,1-4H2 |
| InChIKey | HCHUJEQEXLMVLG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |