C12H17N5O4 — CID 144948843
(2R,3R,5S)-2-(2-amino-6-ethoxypurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 144948843) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is (2R,3R,5S)-2-(2-amino-6-ethoxypurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,5S)-2-(2-amino-6-ethoxypurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 144948843 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2R,3R,5S)-2-(2-amino-6-ethoxypurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO)C[C@H]1O |
| InChI | InChI=1S/C12H17N5O4/c1-2-20-10-8-9(15-12(13)16-10)17(5-14-8)11-7(19)3-6(4-18)21-11/h5-7,11,18-19H,2-4H2,1H3,(H2,13,15,16)/t6-,7+,11+/m0/s1 |
| InChIKey | SKCFEWBPLUZDMJ-MVKOHCKWSA-N |
| XLogP | -0.55 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |