C13H18N5O3Tl — CID 144654161
[[6-ethoxy-9-[5-(hydroxymethyl)-3-methyloxolan-2-yl]purin-2-yl]amino]thallium (PubChem CID 144654161) has the molecular formula C13H18N5O3Tl and a molecular weight of 496.70 g/mol. Its IUPAC name is [[6-ethoxy-9-[5-(hydroxymethyl)-3-methyloxolan-2-yl]purin-2-yl]amino]thallium.
| Compound Name | [[6-ethoxy-9-[5-(hydroxymethyl)-3-methyloxolan-2-yl]purin-2-yl]amino]thallium |
|---|---|
| PubChem CID | 144654161 |
| Molecular Formula | C13H18N5O3Tl |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | [[6-ethoxy-9-[5-(hydroxymethyl)-3-methyloxolan-2-yl]purin-2-yl]amino]thallium |
| SMILES | CCOc1nc(N[Tl])nc2c1ncn2C1OC(CO)CC1C |
| InChI | InChI=1S/C13H18N5O3.Tl/c1-3-20-11-9-10(16-13(14)17-11)18(6-15-9)12-7(2)4-8(5-19)21-12;/h6-8,12,19H,3-5H2,1-2H3,(H-,14,16,17);/q-1;+1 |
| InChIKey | LDMKVILOPATINY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |