C12H16FN5O3 — CID 57116771
[(2S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluorooxolan-2-yl]methanol (PubChem CID 57116771) has the molecular formula C12H16FN5O3 and a molecular weight of 297.29 g/mol. Its IUPAC name is [(2S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluorooxolan-2-yl]methanol.
| Compound Name | [(2S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluorooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 57116771 |
| Molecular Formula | C12H16FN5O3 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [(2S,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluorooxolan-2-yl]methanol |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO)C[C@H]1F |
| InChI | InChI=1S/C12H16FN5O3/c1-2-20-10-8-9(16-12(14)17-10)18(5-15-8)11-7(13)3-6(4-19)21-11/h5-7,11,19H,2-4H2,1H3,(H2,14,16,17)/t6-,7+,11+/m0/s1 |
| InChIKey | JEGAXNYIAYUYJJ-MVKOHCKWSA-N |
| XLogP | 0.43 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |