C14H21N5O5P+ — CID 123836908
2-[5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]ethoxy-hydroxy-oxophosphanium (PubChem CID 123836908) has the molecular formula C14H21N5O5P+ and a molecular weight of 370.33 g/mol. Its IUPAC name is 2-[5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]ethoxy-hydroxy-oxophosphanium.
| Compound Name | 2-[5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]ethoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 123836908 |
| Molecular Formula | C14H21N5O5P+ |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 2-[5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]ethoxy-hydroxy-oxophosphanium |
| SMILES | CCOc1nc(N)nc2c1ncn2C1OC(CCO[P+](=O)O)CC1C |
| InChI | InChI=1S/C14H20N5O5P/c1-3-22-12-10-11(17-14(15)18-12)19(7-16-10)13-8(2)6-9(24-13)4-5-23-25(20)21/h7-9,13H,3-6H2,1-2H3,(H2-,15,17,18,20,21)/p+1 |
| InChIKey | MOYZBQYTTYUVQH-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|