C17H26N6O3 — CID 166530844
[5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methyl 3-methylbutanoate (PubChem CID 166530844) has the molecular formula C17H26N6O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is [5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methyl 3-methylbutanoate.
| Compound Name | [5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 166530844 |
| Molecular Formula | C17H26N6O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methyl 3-methylbutanoate |
| SMILES | CNc1nc(N)nc2c1ncn2C1OC(COC(=O)CC(C)C)CC1C |
| InChI | InChI=1S/C17H26N6O3/c1-9(2)5-12(24)25-7-11-6-10(3)16(26-11)23-8-20-13-14(19-4)21-17(18)22-15(13)23/h8-11,16H,5-7H2,1-4H3,(H3,18,19,21,22) |
| InChIKey | KVVOYXDKSSRPAW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |