C15H22N6O3 — CID 167258822
[5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methyl propanoate (PubChem CID 167258822) has the molecular formula C15H22N6O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is [5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methyl propanoate.
| Compound Name | [5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methyl propanoate |
|---|---|
| PubChem CID | 167258822 |
| Molecular Formula | C15H22N6O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [5-[2-amino-6-(methylamino)purin-9-yl]-4-methyloxolan-2-yl]methyl propanoate |
| SMILES | CCC(=O)OCC1CC(C)C(n2cnc3c(NC)nc(N)nc32)O1 |
| InChI | InChI=1S/C15H22N6O3/c1-4-10(22)23-6-9-5-8(2)14(24-9)21-7-18-11-12(17-3)19-15(16)20-13(11)21/h7-9,14H,4-6H2,1-3H3,(H3,16,17,19,20) |
| InChIKey | DRBIUBHWMPPREE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |