C16H25N6O5P — CID 143911826
[5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-4-methyloxolan-2-yl]methyl ethyl hydrogen phosphate (PubChem CID 143911826) has the molecular formula C16H25N6O5P and a molecular weight of 412.39 g/mol. Its IUPAC name is [5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-4-methyloxolan-2-yl]methyl ethyl hydrogen phosphate.
| Compound Name | [5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-4-methyloxolan-2-yl]methyl ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 143911826 |
| Molecular Formula | C16H25N6O5P |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [5-[2-amino-6-(azetidin-1-yl)purin-9-yl]-4-methyloxolan-2-yl]methyl ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)OCC1CC(C)C(n2cnc3c(N4CCC4)nc(N)nc32)O1 |
| InChI | InChI=1S/C16H25N6O5P/c1-3-25-28(23,24)26-8-11-7-10(2)15(27-11)22-9-18-12-13(21-5-4-6-21)19-16(17)20-14(12)22/h9-11,15H,3-8H2,1-2H3,(H,23,24)(H2,17,19,20) |
| InChIKey | CSXWHZWBIPXWPG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|