C15H23N6O8P — CID 54006946
[[(2S,3S,4R,5R)-5-(2-amino-6-piperidin-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] dihydrogen phosphate (PubChem CID 54006946) has the molecular formula C15H23N6O8P and a molecular weight of 446.36 g/mol. Its IUPAC name is [[(2S,3S,4R,5R)-5-(2-amino-6-piperidin-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] dihydrogen phosphate.
| Compound Name | [[(2S,3S,4R,5R)-5-(2-amino-6-piperidin-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 54006946 |
| Molecular Formula | C15H23N6O8P |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | [[(2S,3S,4R,5R)-5-(2-amino-6-piperidin-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] dihydrogen phosphate |
| SMILES | Nc1nc(N2CCCCC2)c2ncn([C@@H]3O[C@H](C(O)OP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C15H23N6O8P/c16-15-18-11(20-4-2-1-3-5-20)7-12(19-15)21(6-17-7)13-9(23)8(22)10(28-13)14(24)29-30(25,26)27/h6,8-10,13-14,22-24H,1-5H2,(H2,16,18,19)(H2,25,26,27)/t8-,9+,10-,13+,14?/m0/s1 |
| InChIKey | KPODIFNNYGELKO-ZSSIPKAESA-N |
| XLogP | -1.55 |
| TPSA | 209.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|