C15H22N5O7P — CID 146472908
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-pyrrolidin-1-ylpurin-9-yl)oxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146472908) has the molecular formula C15H22N5O7P and a molecular weight of 415.34 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-pyrrolidin-1-ylpurin-9-yl)oxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-pyrrolidin-1-ylpurin-9-yl)oxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146472908 |
| Molecular Formula | C15H22N5O7P |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-pyrrolidin-1-ylpurin-9-yl)oxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2cnc3c(N4CCCC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22N5O7P/c21-11-9(5-26-8-28(23,24)25)27-15(12(11)22)20-7-18-10-13(16-6-17-14(10)20)19-3-1-2-4-19/h6-7,9,11-12,15,21-22H,1-5,8H2,(H2,23,24,25)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | SRRRFAPQJLLUJI-SDBHATRESA-N |
| XLogP | -0.80 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|