C17H21N6O7P — CID 146472915
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[methyl(pyridin-2-yl)amino]purin-9-yl]oxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146472915) has the molecular formula C17H21N6O7P and a molecular weight of 452.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[methyl(pyridin-2-yl)amino]purin-9-yl]oxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[methyl(pyridin-2-yl)amino]purin-9-yl]oxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146472915 |
| Molecular Formula | C17H21N6O7P |
| Molecular Weight | 452.36 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[methyl(pyridin-2-yl)amino]purin-9-yl]oxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | CN(c1ccccn1)c1ncnc2c1ncn2[C@@H]1O[C@H](COCP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H21N6O7P/c1-22(11-4-2-3-5-18-11)15-12-16(20-7-19-15)23(8-21-12)17-14(25)13(24)10(30-17)6-29-9-31(26,27)28/h2-5,7-8,10,13-14,17,24-25H,6,9H2,1H3,(H2,26,27,28)/t10-,13-,14-,17-/m1/s1 |
| InChIKey | JSCRLZOTMVPRJZ-IWCJZZDYSA-N |
| XLogP | -0.24 |
| TPSA | 176.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|