C16H23N4O8P — CID 146472837
[(2R,3S,4R,5R)-5-(6-cyclopentyloxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146472837) has the molecular formula C16H23N4O8P and a molecular weight of 430.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-cyclopentyloxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(6-cyclopentyloxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146472837 |
| Molecular Formula | C16H23N4O8P |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-cyclopentyloxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2cnc3c(OC4CCCC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23N4O8P/c21-12-10(5-26-8-29(23,24)25)28-16(13(12)22)20-7-19-11-14(20)17-6-18-15(11)27-9-3-1-2-4-9/h6-7,9-10,12-13,16,21-22H,1-5,8H2,(H2,23,24,25)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | KHYWAQFMXNKGIJ-XNIJJKJLSA-N |
| XLogP | -0.08 |
| TPSA | 169.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|