C16H26N5O6P — CID 146506625
[(2S,3S,4R,5R)-5-[6-(tert-butylamino)purin-9-yl]-4-hydroxy-3-methyloxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146506625) has the molecular formula C16H26N5O6P and a molecular weight of 415.39 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[6-(tert-butylamino)purin-9-yl]-4-hydroxy-3-methyloxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[6-(tert-butylamino)purin-9-yl]-4-hydroxy-3-methyloxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146506625 |
| Molecular Formula | C16H26N5O6P |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[6-(tert-butylamino)purin-9-yl]-4-hydroxy-3-methyloxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | C[C@H]1[C@@H](O)[C@H](n2cnc3c(NC(C)(C)C)ncnc32)O[C@@H]1COCP(=O)(O)O |
| InChI | InChI=1S/C16H26N5O6P/c1-9-10(5-26-8-28(23,24)25)27-15(12(9)22)21-7-19-11-13(20-16(2,3)4)17-6-18-14(11)21/h6-7,9-10,12,15,22H,5,8H2,1-4H3,(H,17,18,20)(H2,23,24,25)/t9-,10-,12-,15-/m1/s1 |
| InChIKey | WFEYYOOPRSGSTI-NDLNZWKESA-N |
| XLogP | 1.08 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|