C20H24N5O7P — CID 146473097
[(2R,3S,4R,5R)-5-[6-(2,3-dihydro-1H-inden-1-ylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 146473097) has the molecular formula C20H24N5O7P and a molecular weight of 477.41 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(2,3-dihydro-1H-inden-1-ylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(2,3-dihydro-1H-inden-1-ylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 146473097 |
| Molecular Formula | C20H24N5O7P |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(2,3-dihydro-1H-inden-1-ylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2cnc3c(NC4CCc5ccccc54)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H24N5O7P/c26-16-14(7-31-10-33(28,29)30)32-20(17(16)27)25-9-23-15-18(21-8-22-19(15)25)24-13-6-5-11-3-1-2-4-12(11)13/h1-4,8-9,13-14,16-17,20,26-27H,5-7,10H2,(H,21,22,24)(H2,28,29,30)/t13?,14-,16-,17-,20-/m1/s1 |
| InChIKey | PPGADOMBHKUNNX-UEXBNONGSA-N |
| XLogP | 0.70 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|