C27H29N5O5 — CID 70402133
(2S,3S,4R,5R)-2-[hydroxy(phenylmethoxy)methyl]-5-[6-(1,2,3,4-tetrahydronaphthalen-1-ylamino)purin-9-yl]oxolane-3,4-diol (PubChem CID 70402133) has the molecular formula C27H29N5O5 and a molecular weight of 503.56 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[hydroxy(phenylmethoxy)methyl]-5-[6-(1,2,3,4-tetrahydronaphthalen-1-ylamino)purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-[hydroxy(phenylmethoxy)methyl]-5-[6-(1,2,3,4-tetrahydronaphthalen-1-ylamino)purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 70402133 |
| Molecular Formula | C27H29N5O5 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | (2S,3S,4R,5R)-2-[hydroxy(phenylmethoxy)methyl]-5-[6-(1,2,3,4-tetrahydronaphthalen-1-ylamino)purin-9-yl]oxolane-3,4-diol |
| SMILES | OC(OCc1ccccc1)[C@H]1O[C@@H](n2cnc3c(NC4CCCc5ccccc54)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H29N5O5/c33-21-22(34)26(37-23(21)27(35)36-13-16-7-2-1-3-8-16)32-15-30-20-24(28-14-29-25(20)32)31-19-12-6-10-17-9-4-5-11-18(17)19/h1-5,7-9,11,14-15,19,21-23,26-27,33-35H,6,10,12-13H2,(H,28,29,31)/t19?,21-,22+,23-,26+,27?/m0/s1 |
| InChIKey | VEKCGIMVICDDNQ-LCNRAAIVSA-N |
| XLogP | 2.47 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|