C20H24N6O5S — CID 58296189
2-[(2R,3S,4R,5R)-5-[6-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide (PubChem CID 58296189) has the molecular formula C20H24N6O5S and a molecular weight of 460.52 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-[6-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide.
| Compound Name | 2-[(2R,3S,4R,5R)-5-[6-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 58296189 |
| Molecular Formula | C20H24N6O5S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-[6-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide |
| SMILES | NS(=O)(=O)CC[C@H]1O[C@@H](n2cnc3c(N[C@@H]4CCc5ccccc54)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H24N6O5S/c21-32(29,30)8-7-14-16(27)17(28)20(31-14)26-10-24-15-18(22-9-23-19(15)26)25-13-6-5-11-3-1-2-4-12(11)13/h1-4,9-10,13-14,16-17,20,27-28H,5-8H2,(H2,21,29,30)(H,22,23,25)/t13-,14-,16-,17-,20-/m1/s1 |
| InChIKey | BCVKYQBJRGWHDF-CDUMDVBJSA-N |
| XLogP | 0.22 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |