C20H25N7O5S — CID 126688086
6-(2,3-dihydro-1H-inden-1-ylamino)-9-[(2R,3R,4R)-3,4-dihydroxy-3-methyl-5-[(sulfamoylamino)methyl]oxolan-2-yl]purine (PubChem CID 126688086) has the molecular formula C20H25N7O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-1-ylamino)-9-[(2R,3R,4R)-3,4-dihydroxy-3-methyl-5-[(sulfamoylamino)methyl]oxolan-2-yl]purine.
| Compound Name | 6-(2,3-dihydro-1H-inden-1-ylamino)-9-[(2R,3R,4R)-3,4-dihydroxy-3-methyl-5-[(sulfamoylamino)methyl]oxolan-2-yl]purine |
|---|---|
| PubChem CID | 126688086 |
| Molecular Formula | C20H25N7O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-1-ylamino)-9-[(2R,3R,4R)-3,4-dihydroxy-3-methyl-5-[(sulfamoylamino)methyl]oxolan-2-yl]purine |
| SMILES | C[C@@]1(O)[C@H](O)C(CNS(N)(=O)=O)O[C@H]1n1cnc2c(NC3CCc4ccccc43)ncnc21 |
| InChI | InChI=1S/C20H25N7O5S/c1-20(29)16(28)14(8-25-33(21,30)31)32-19(20)27-10-24-15-17(22-9-23-18(15)27)26-13-7-6-11-4-2-3-5-12(11)13/h2-5,9-10,13-14,16,19,25,28-29H,6-8H2,1H3,(H2,21,30,31)(H,22,23,26)/t13?,14?,16-,19-,20-/m1/s1 |
| InChIKey | BIWXZPIMKOVMKS-LVSCNKDFSA-N |
| XLogP | -0.27 |
| TPSA | 177.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |