C22H28N6O5S — CID 126688089
2-[(3S,4R,5R)-5-[6-[(3,3-dimethyl-1,2-dihydroinden-1-yl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide (PubChem CID 126688089) has the molecular formula C22H28N6O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-[(3S,4R,5R)-5-[6-[(3,3-dimethyl-1,2-dihydroinden-1-yl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide.
| Compound Name | 2-[(3S,4R,5R)-5-[6-[(3,3-dimethyl-1,2-dihydroinden-1-yl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 126688089 |
| Molecular Formula | C22H28N6O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2-[(3S,4R,5R)-5-[6-[(3,3-dimethyl-1,2-dihydroinden-1-yl)amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide |
| SMILES | CC1(C)CC(Nc2ncnc3c2ncn3[C@@H]2OC(CCS(N)(=O)=O)[C@@H](O)[C@H]2O)c2ccccc21 |
| InChI | InChI=1S/C22H28N6O5S/c1-22(2)9-14(12-5-3-4-6-13(12)22)27-19-16-20(25-10-24-19)28(11-26-16)21-18(30)17(29)15(33-21)7-8-34(23,31)32/h3-6,10-11,14-15,17-18,21,29-30H,7-9H2,1-2H3,(H2,23,31,32)(H,24,25,27)/t14?,15?,17-,18-,21-/m1/s1 |
| InChIKey | KVQOPECWSBESGS-OWORFONUSA-N |
| XLogP | 0.96 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |