C18H22N6O5S — CID 147999168
2-[(2R,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide (PubChem CID 147999168) has the molecular formula C18H22N6O5S and a molecular weight of 434.48 g/mol. Its IUPAC name is 2-[(2R,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide.
| Compound Name | 2-[(2R,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 147999168 |
| Molecular Formula | C18H22N6O5S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-[(2R,3S,4R,5R)-5-[6-(benzylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethanesulfonamide |
| SMILES | NS(=O)(=O)CC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H22N6O5S/c19-30(27,28)7-6-12-14(25)15(26)18(29-12)24-10-23-13-16(21-9-22-17(13)24)20-8-11-4-2-1-3-5-11/h1-5,9-10,12,14-15,18,25-26H,6-8H2,(H2,19,27,28)(H,20,21,22)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | IWPBENOAXZLSIY-SCFUHWHPSA-N |
| XLogP | -0.26 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |