C16H19N7O6S — CID 170721879
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(pyridin-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate (PubChem CID 170721879) has the molecular formula C16H19N7O6S and a molecular weight of 437.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(pyridin-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(pyridin-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 170721879 |
| Molecular Formula | C16H19N7O6S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(pyridin-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccccn4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19N7O6S/c17-30(26,27)28-6-10-12(24)13(25)16(29-10)23-8-22-11-14(20-7-21-15(11)23)19-5-9-3-1-2-4-18-9/h1-4,7-8,10,12-13,16,24-25H,5-6H2,(H2,17,26,27)(H,19,20,21)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | ALTILCDKQHZPMD-XNIJJKJLSA-N |
| XLogP | -1.33 |
| TPSA | 187.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |