C17H20ClN6O7P — CID 153325458
[(2R,3S,4R,5R)-5-[2-chloro-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 153325458) has the molecular formula C17H20ClN6O7P and a molecular weight of 486.81 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-chloro-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[2-chloro-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 153325458 |
| Molecular Formula | C17H20ClN6O7P |
| Molecular Weight | 486.81 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-chloro-6-(pyridin-2-ylmethylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2cnc3c(NCc4ccccn4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H20ClN6O7P/c18-17-22-14(20-5-9-3-1-2-4-19-9)11-15(23-17)24(7-21-11)16-13(26)12(25)10(31-16)6-30-8-32(27,28)29/h1-4,7,10,12-13,16,25-26H,5-6,8H2,(H,20,22,23)(H2,27,28,29)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | DRPRHELCKDVINK-XNIJJKJLSA-N |
| XLogP | 0.26 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.81 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|