C20H25ClN5O7P — CID 162667721
3-[[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]propylphosphonic acid (PubChem CID 162667721) has the molecular formula C20H25ClN5O7P and a molecular weight of 513.88 g/mol. Its IUPAC name is 3-[[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]propylphosphonic acid.
| Compound Name | 3-[[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]propylphosphonic acid |
|---|---|
| PubChem CID | 162667721 |
| Molecular Formula | C20H25ClN5O7P |
| Molecular Weight | 513.88 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 3-[[(2R,3S,4R,5R)-5-[6-(benzylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCOC[C@H]1O[C@@H](n2cnc3c(NCc4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H25ClN5O7P/c21-20-24-17(22-9-12-5-2-1-3-6-12)14-18(25-20)26(11-23-14)19-16(28)15(27)13(33-19)10-32-7-4-8-34(29,30)31/h1-3,5-6,11,13,15-16,19,27-28H,4,7-10H2,(H,22,24,25)(H2,29,30,31)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | DFMOUAQWNSKKBD-NVQRDWNXSA-N |
| XLogP | 1.30 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.88 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|