C19H25ClN5O6PS — CID 159388438
2-[(2R,4S,5R)-5-[2-chloro-6-[[(1S)-1-phenylethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid;sulfane (PubChem CID 159388438) has the molecular formula C19H25ClN5O6PS and a molecular weight of 517.93 g/mol. Its IUPAC name is 2-[(2R,4S,5R)-5-[2-chloro-6-[[(1S)-1-phenylethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid;sulfane.
| Compound Name | 2-[(2R,4S,5R)-5-[2-chloro-6-[[(1S)-1-phenylethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid;sulfane |
|---|---|
| PubChem CID | 159388438 |
| Molecular Formula | C19H25ClN5O6PS |
| Molecular Weight | 517.93 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 2-[(2R,4S,5R)-5-[2-chloro-6-[[(1S)-1-phenylethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid;sulfane |
| SMILES | C[C@H](Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CCP(=O)(O)O)C(O)[C@@H]1O)c1ccccc1.S |
| InChI | InChI=1S/C19H23ClN5O6P.H2S/c1-10(11-5-3-2-4-6-11)22-16-13-17(24-19(20)23-16)25(9-21-13)18-15(27)14(26)12(31-18)7-8-32(28,29)30;/h2-6,9-10,12,14-15,18,26-27H,7-8H2,1H3,(H,22,23,24)(H2,28,29,30);1H2/t10-,12+,14?,15-,18+;/m0./s1 |
| InChIKey | LLUKPHPIDOPUOX-LGGGBIMMSA-N |
| XLogP | 1.95 |
| TPSA | 162.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.93 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|