C20H24ClN4O8PS — CID 162148676
[(2S,3S,4R,5R)-5-[2-chloro-6-[(2R)-2-phenylpropyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 162148676) has the molecular formula C20H24ClN4O8PS and a molecular weight of 546.93 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[2-chloro-6-[(2R)-2-phenylpropyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[2-chloro-6-[(2R)-2-phenylpropyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 162148676 |
| Molecular Formula | C20H24ClN4O8PS |
| Molecular Weight | 546.93 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[2-chloro-6-[(2R)-2-phenylpropyl]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | C[C@H](Cc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CS(=O)(=O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H24ClN4O8PS/c1-11(12-5-3-2-4-6-12)7-13-15-18(24-20(21)23-13)25(9-22-15)19-17(27)16(26)14(33-19)8-35(31,32)10-34(28,29)30/h2-6,9,11,14,16-17,19,26-27H,7-8,10H2,1H3,(H2,28,29,30)/t11-,14-,16-,17-,19-/m1/s1 |
| InChIKey | ZKXDGSWRCRVGLR-MMKFELLXSA-N |
| XLogP | 1.00 |
| TPSA | 184.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.93 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|