C19H23ClN5O6P — CID 161297558
2-[(2R,4S,5R)-5-[6-[benzyl(methyl)amino]-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid (PubChem CID 161297558) has the molecular formula C19H23ClN5O6P and a molecular weight of 483.85 g/mol. Its IUPAC name is 2-[(2R,4S,5R)-5-[6-[benzyl(methyl)amino]-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,4S,5R)-5-[6-[benzyl(methyl)amino]-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 161297558 |
| Molecular Formula | C19H23ClN5O6P |
| Molecular Weight | 483.85 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 2-[(2R,4S,5R)-5-[6-[benzyl(methyl)amino]-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethylphosphonic acid |
| SMILES | CN(Cc1ccccc1)c1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CCP(=O)(O)O)C(O)[C@@H]1O |
| InChI | InChI=1S/C19H23ClN5O6P/c1-24(9-11-5-3-2-4-6-11)16-13-17(23-19(20)22-16)25(10-21-13)18-15(27)14(26)12(31-18)7-8-32(28,29)30/h2-6,10,12,14-15,18,26-27H,7-9H2,1H3,(H2,28,29,30)/t12-,14?,15+,18-/m1/s1 |
| InChIKey | VHEFPCWOVRNUHC-OWYXCUOISA-N |
| XLogP | 1.30 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.85 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|