C26H26ClN5O8P2 — CID 159183629
[2-[(2R,3R,5R)-5-[6-(anthracen-2-ylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 159183629) has the molecular formula C26H26ClN5O8P2 and a molecular weight of 633.92 g/mol. Its IUPAC name is [2-[(2R,3R,5R)-5-[6-(anthracen-2-ylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [2-[(2R,3R,5R)-5-[6-(anthracen-2-ylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 159183629 |
| Molecular Formula | C26H26ClN5O8P2 |
| Molecular Weight | 633.92 g/mol |
| Exact Mass | 633.09 |
| IUPAC Name | [2-[(2R,3R,5R)-5-[6-(anthracen-2-ylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)CC[C@H]1O[C@@H](n2cnc3c(Nc4ccc5cc6ccccc6cc5c4)nc(Cl)nc32)C(O)[C@H]1O |
| InChI | InChI=1S/C26H26ClN5O8P2/c27-26-30-23(29-18-6-5-16-9-14-3-1-2-4-15(14)10-17(16)11-18)20-24(31-26)32(12-28-20)25-22(34)21(33)19(40-25)7-8-41(35,36)13-42(37,38)39/h1-6,9-12,19,21-22,25,33-34H,7-8,13H2,(H,35,36)(H,29,30,31)(H2,37,38,39)/t19-,21+,22?,25-/m1/s1 |
| InChIKey | ITLOWZHJEDGEDR-YWEFRBEISA-N |
| XLogP | 3.94 |
| TPSA | 200.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|