C20H25ClFN5O8P2 — CID 158594151
[2-[(2R,3R,5R)-5-[2-chloro-6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 158594151) has the molecular formula C20H25ClFN5O8P2 and a molecular weight of 579.85 g/mol. Its IUPAC name is [2-[(2R,3R,5R)-5-[2-chloro-6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [2-[(2R,3R,5R)-5-[2-chloro-6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 158594151 |
| Molecular Formula | C20H25ClFN5O8P2 |
| Molecular Weight | 579.85 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | [2-[(2R,3R,5R)-5-[2-chloro-6-[[(1S)-1-(4-fluorophenyl)ethyl]amino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@H](Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](CCP(=O)(O)CP(=O)(O)O)[C@H](O)C1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25ClFN5O8P2/c1-10(11-2-4-12(22)5-3-11)24-17-14-18(26-20(21)25-17)27(8-23-14)19-16(29)15(28)13(35-19)6-7-36(30,31)9-37(32,33)34/h2-5,8,10,13,15-16,19,28-29H,6-7,9H2,1H3,(H,30,31)(H,24,25,26)(H2,32,33,34)/t10-,13+,15-,16?,19+/m0/s1 |
| InChIKey | MRJGIHPTMQNFIH-IEVLALGNSA-N |
| XLogP | 2.21 |
| TPSA | 200.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.85 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|