C12H19N5O8P2 — CID 46228943
[2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 46228943) has the molecular formula C12H19N5O8P2 and a molecular weight of 423.26 g/mol. Its IUPAC name is [2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 46228943 |
| Molecular Formula | C12H19N5O8P2 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | [2-[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]ethyl-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CCP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H19N5O8P2/c13-10-7-11(15-3-14-10)17(4-16-7)12-9(19)8(18)6(25-12)1-2-26(20,21)5-27(22,23)24/h3-4,6,8-9,12,18-19H,1-2,5H2,(H,20,21)(H2,13,14,15)(H2,22,23,24)/t6-,8-,9-,12-/m1/s1 |
| InChIKey | ABWZRENEVQXJCY-WOUKDFQISA-N |
| XLogP | -1.18 |
| TPSA | 214.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|