C16H25ClN5O6P — CID 161451576
[(2R,3S,4R,5R)-5-[6-(butan-2-ylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-methylphosphinic acid (PubChem CID 161451576) has the molecular formula C16H25ClN5O6P and a molecular weight of 449.83 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(butan-2-ylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-methylphosphinic acid.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(butan-2-ylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-methylphosphinic acid |
|---|---|
| PubChem CID | 161451576 |
| Molecular Formula | C16H25ClN5O6P |
| Molecular Weight | 449.83 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(butan-2-ylamino)-2-chloropurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl-methylphosphinic acid |
| SMILES | CCC(C)Nc1nc(Cl)nc2c1ncn2[C@@H]1O[C@H](COCP(C)(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H25ClN5O6P/c1-4-8(2)19-13-10-14(21-16(17)20-13)22(6-18-10)15-12(24)11(23)9(28-15)5-27-7-29(3,25)26/h6,8-9,11-12,15,23-24H,4-5,7H2,1-3H3,(H,25,26)(H,19,20,21)/t8?,9-,11-,12-,15-/m1/s1 |
| InChIKey | MQBYWOYMJACNNZ-YXYADJKSSA-N |
| XLogP | 1.18 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.83 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|