C15H21ClN5O8P — CID 153325449
[(2R,3S,4R,5R)-5-(2-chloro-6-morpholin-4-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 153325449) has the molecular formula C15H21ClN5O8P and a molecular weight of 465.79 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(2-chloro-6-morpholin-4-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R,5R)-5-(2-chloro-6-morpholin-4-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 153325449 |
| Molecular Formula | C15H21ClN5O8P |
| Molecular Weight | 465.79 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(2-chloro-6-morpholin-4-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1O[C@@H](n2cnc3c(N4CCOCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21ClN5O8P/c16-15-18-12(20-1-3-27-4-2-20)9-13(19-15)21(6-17-9)14-11(23)10(22)8(29-14)5-28-7-30(24,25)26/h6,8,10-11,14,22-23H,1-5,7H2,(H2,24,25,26)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | FEUUEOAEMGJPIF-IDTAVKCVSA-N |
| XLogP | -0.91 |
| TPSA | 172.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.79 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|