C16H23ClN5O7P — CID 154988330
[(2R,3S,4R)-5-(2-chloro-6-piperidin-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 154988330) has the molecular formula C16H23ClN5O7P and a molecular weight of 463.82 g/mol. Its IUPAC name is [(2R,3S,4R)-5-(2-chloro-6-piperidin-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4R)-5-(2-chloro-6-piperidin-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 154988330 |
| Molecular Formula | C16H23ClN5O7P |
| Molecular Weight | 463.82 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | [(2R,3S,4R)-5-(2-chloro-6-piperidin-1-ylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | O=P(O)(O)COC[C@H]1OC(n2cnc3c(N4CCCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23ClN5O7P/c17-16-19-13(21-4-2-1-3-5-21)10-14(20-16)22(7-18-10)15-12(24)11(23)9(29-15)6-28-8-30(25,26)27/h7,9,11-12,15,23-24H,1-6,8H2,(H2,25,26,27)/t9-,11-,12-,15?/m1/s1 |
| InChIKey | MITPPFXBNCXNJV-FJFSNTMWSA-N |
| XLogP | 0.24 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.82 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|