C17H25ClN5O6P — CID 166644816
[(2R,3S,4S)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxymethylphosphonic acid (PubChem CID 166644816) has the molecular formula C17H25ClN5O6P and a molecular weight of 461.84 g/mol. Its IUPAC name is [(2R,3S,4S)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxymethylphosphonic acid.
| Compound Name | [(2R,3S,4S)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 166644816 |
| Molecular Formula | C17H25ClN5O6P |
| Molecular Weight | 461.84 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [(2R,3S,4S)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxymethylphosphonic acid |
| SMILES | C[C@@H]1C(n2cnc3c(NC4CCCC4)nc(Cl)nc32)O[C@H](COCP(=O)(O)O)[C@H]1O |
| InChI | InChI=1S/C17H25ClN5O6P/c1-9-13(24)11(6-28-8-30(25,26)27)29-16(9)23-7-19-12-14(20-10-4-2-3-5-10)21-17(18)22-15(12)23/h7,9-11,13,16,24H,2-6,8H2,1H3,(H,20,21,22)(H2,25,26,27)/t9-,11+,13-,16?/m0/s1 |
| InChIKey | CZQKHAGZOKQMII-YYOIJTMBSA-N |
| XLogP | 1.88 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.84 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|