C18H27ClN5O8P — CID 147817158
[1-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-3-hydroxypropyl]phosphonic acid (PubChem CID 147817158) has the molecular formula C18H27ClN5O8P and a molecular weight of 507.87 g/mol. Its IUPAC name is [1-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-3-hydroxypropyl]phosphonic acid.
| Compound Name | [1-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-3-hydroxypropyl]phosphonic acid |
|---|---|
| PubChem CID | 147817158 |
| Molecular Formula | C18H27ClN5O8P |
| Molecular Weight | 507.87 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | [1-[[(2R,3S,4R,5R)-5-[2-chloro-6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-3-hydroxypropyl]phosphonic acid |
| SMILES | O=P(O)(O)C(CCO)OC[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H27ClN5O8P/c19-18-22-15(21-9-3-1-2-4-9)12-16(23-18)24(8-20-12)17-14(27)13(26)10(32-17)7-31-11(5-6-25)33(28,29)30/h8-11,13-14,17,25-27H,1-7H2,(H,21,22,23)(H2,28,29,30)/t10-,11?,13-,14-,17-/m1/s1 |
| InChIKey | HONLNIHVLNNFKM-YAOZREJRSA-N |
| XLogP | 0.36 |
| TPSA | 192.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.87 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|