C20H30ClN6O8P — CID 149153845
[1-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(cyclopropylmethoxy)ethyl]phosphonic acid (PubChem CID 149153845) has the molecular formula C20H30ClN6O8P and a molecular weight of 548.92 g/mol. Its IUPAC name is [1-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(cyclopropylmethoxy)ethyl]phosphonic acid.
| Compound Name | [1-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(cyclopropylmethoxy)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 149153845 |
| Molecular Formula | C20H30ClN6O8P |
| Molecular Weight | 548.92 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | [1-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-(cyclopropylmethoxy)ethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(COCC1CC1)OC[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H30ClN6O8P/c21-20-23-17(22-11-3-1-2-4-11)14-18(24-20)27(26-25-14)19-16(29)15(28)12(35-19)8-34-13(36(30,31)32)9-33-7-10-5-6-10/h10-13,15-16,19,28-29H,1-9H2,(H,22,23,24)(H2,30,31,32)/t12-,13?,15-,16-,19-/m1/s1 |
| InChIKey | RMPWKQSNGFURSX-BENWTFJNSA-N |
| XLogP | 0.80 |
| TPSA | 194.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.92 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|