C17H26ClN5O9P2 — CID 153359109
[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]methylphosphonic acid (PubChem CID 153359109) has the molecular formula C17H26ClN5O9P2 and a molecular weight of 541.82 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 153359109 |
| Molecular Formula | C17H26ClN5O9P2 |
| Molecular Weight | 541.82 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-methoxyphosphoryl]methylphosphonic acid |
| SMILES | COP(=O)(CP(=O)(O)O)OC[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H26ClN5O9P2/c1-30-34(29,8-33(26,27)28)31-7-11-14(24)15(25)17(32-11)23-16-13(21-22-23)10(6-12(18)20-16)19-9-4-2-3-5-9/h6,9,11,14-15,17,24-25H,2-5,7-8H2,1H3,(H,19,20)(H2,26,27,28)/t11-,14-,15-,17-,34?/m1/s1 |
| InChIKey | RGIBZIXVELCMHX-ZSERDDOISA-N |
| XLogP | 1.44 |
| TPSA | 198.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.82 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|