C18H27ClN5O9PS — CID 149443305
[1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-hydroxypropyl]phosphonic acid (PubChem CID 149443305) has the molecular formula C18H27ClN5O9PS and a molecular weight of 555.93 g/mol. Its IUPAC name is [1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-hydroxypropyl]phosphonic acid.
| Compound Name | [1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-hydroxypropyl]phosphonic acid |
|---|---|
| PubChem CID | 149443305 |
| Molecular Formula | C18H27ClN5O9PS |
| Molecular Weight | 555.93 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | [1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-hydroxypropyl]phosphonic acid |
| SMILES | CC(O)C(P(=O)(O)O)S(=O)(=O)C[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H27ClN5O9PS/c1-8(25)18(34(28,29)30)35(31,32)7-11-14(26)15(27)17(33-11)24-16-13(22-23-24)10(6-12(19)21-16)20-9-4-2-3-5-9/h6,8-9,11,14-15,17-18,25-27H,2-5,7H2,1H3,(H,20,21)(H2,28,29,30)/t8?,11-,14-,15-,17-,18?/m1/s1 |
| InChIKey | YWEKSGRZZHRNFZ-WISYILGTSA-N |
| XLogP | -0.25 |
| TPSA | 217.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.93 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|