C20H29ClN5O8P — CID 153358954
[2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-methylbut-3-en-2-yl]phosphonic acid (PubChem CID 153358954) has the molecular formula C20H29ClN5O8P and a molecular weight of 533.91 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-methylbut-3-en-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-methylbut-3-en-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 153358954 |
| Molecular Formula | C20H29ClN5O8P |
| Molecular Weight | 533.91 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-methylbut-3-en-2-yl]phosphonic acid |
| SMILES | C=C(C)C(CO)(OC[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C20H29ClN5O8P/c1-10(2)20(9-27,35(30,31)32)33-8-13-16(28)17(29)19(34-13)26-18-15(24-25-26)12(7-14(21)23-18)22-11-5-3-4-6-11/h7,11,13,16-17,19,27-29H,1,3-6,8-9H2,2H3,(H,22,23)(H2,30,31,32)/t13-,16-,17-,19-,20?/m1/s1 |
| InChIKey | VTUVMVRNARCQID-WJKFABHDSA-N |
| XLogP | 0.91 |
| TPSA | 192.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.91 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|