C19H26ClN4O8P — CID 147968987
[3-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]oxetan-3-yl]phosphonic acid (PubChem CID 147968987) has the molecular formula C19H26ClN4O8P and a molecular weight of 504.86 g/mol. Its IUPAC name is [3-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]oxetan-3-yl]phosphonic acid.
| Compound Name | [3-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]oxetan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 147968987 |
| Molecular Formula | C19H26ClN4O8P |
| Molecular Weight | 504.86 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | [3-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]oxetan-3-yl]phosphonic acid |
| SMILES | O=P(O)(O)C1(OC[C@H]2O[C@@H](n3ncc4c(NC5CCCC5)cc(Cl)nc43)[C@H](O)[C@@H]2O)COC1 |
| InChI | InChI=1S/C19H26ClN4O8P/c20-14-5-12(22-10-3-1-2-4-10)11-6-21-24(17(11)23-14)18-16(26)15(25)13(32-18)7-31-19(8-30-9-19)33(27,28)29/h5-6,10,13,15-16,18,25-26H,1-4,7-9H2,(H,22,23)(H2,27,28,29)/t13-,15-,16-,18-/m1/s1 |
| InChIKey | IQYYFGGYBNRFME-GFOCRRMGSA-N |
| XLogP | 0.98 |
| TPSA | 168.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.86 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|