C18H26ClFN4O8P2Si — CID 149475835
CID 149475835 (PubChem CID 149475835) has the molecular formula C18H26ClFN4O8P2Si and a molecular weight of 570.91 g/mol.
| Compound Name | CID 149475835 |
|---|---|
| PubChem CID | 149475835 |
| Molecular Formula | C18H26ClFN4O8P2Si |
| Molecular Weight | 570.91 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | — |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1CO[C@@H](n2ncc3c(NC4CCCC4)cc(Cl)nc32)C([Si]F)[C@@H]1O |
| InChI | InChI=1S/C18H26ClFN4O8P2Si/c19-14-5-13(22-11-3-1-2-4-11)12-6-21-24(17(12)23-14)18-16(35-20)15(25)10(7-31-18)8-32-34(29,30)9-33(26,27)28/h5-6,10-11,15-16,18,25H,1-4,7-9H2,(H,22,23)(H,29,30)(H2,26,27,28)/t10-,15-,16?,18-/m1/s1 |
| InChIKey | VEAOIMGWMPJMDY-GLLYIPLTSA-N |
| XLogP | 2.66 |
| TPSA | 176.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|