C20H23ClFN7O8P2 — CID 174229345
[[(2S,3S,4R)-3-azido-5-[6-chloro-4-[1-(2-fluorophenyl)ethylamino]pyrazolo[5,4-b]pyridin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 174229345) has the molecular formula C20H23ClFN7O8P2 and a molecular weight of 605.84 g/mol. Its IUPAC name is [[(2S,3S,4R)-3-azido-5-[6-chloro-4-[1-(2-fluorophenyl)ethylamino]pyrazolo[5,4-b]pyridin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2S,3S,4R)-3-azido-5-[6-chloro-4-[1-(2-fluorophenyl)ethylamino]pyrazolo[5,4-b]pyridin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 174229345 |
| Molecular Formula | C20H23ClFN7O8P2 |
| Molecular Weight | 605.84 g/mol |
| Exact Mass | 605.08 |
| IUPAC Name | [[(2S,3S,4R)-3-azido-5-[6-chloro-4-[1-(2-fluorophenyl)ethylamino]pyrazolo[5,4-b]pyridin-1-yl]-4-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CC(Nc1cc(Cl)nc2c1cnn2C1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](N=[N+]=[N-])[C@H]1O)c1ccccc1F |
| InChI | InChI=1S/C20H23ClFN7O8P2/c1-10(11-4-2-3-5-13(11)22)25-14-6-16(21)26-19-12(14)7-24-29(19)20-18(30)17(27-28-23)15(37-20)8-36-39(34,35)9-38(31,32)33/h2-7,10,15,17-18,20,30H,8-9H2,1H3,(H,25,26)(H,34,35)(H2,31,32,33)/t10?,15-,17-,18-,20?/m1/s1 |
| InChIKey | YCXJOKNZOSYIMM-UYGQMMSSSA-N |
| XLogP | 3.67 |
| TPSA | 225.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|