C21H23ClFN5O9P2 — CID 158428206
[[(2R,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrazolo[3,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 158428206) has the molecular formula C21H23ClFN5O9P2 and a molecular weight of 605.84 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrazolo[3,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrazolo[3,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 158428206 |
| Molecular Formula | C21H23ClFN5O9P2 |
| Molecular Weight | 605.84 g/mol |
| Exact Mass | 605.06 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-chloro-5-cyano-4-[[(1S)-1-(4-fluorophenyl)ethyl]amino]pyrazolo[3,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@H](Nc1c(C#N)c(Cl)nc2c1cnn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23ClFN5O9P2/c1-10(11-2-4-12(23)5-3-11)26-16-13(6-24)19(22)27-20-14(16)7-25-28(20)21-18(30)17(29)15(37-21)8-36-39(34,35)9-38(31,32)33/h2-5,7,10,15,17-18,21,29-30H,8-9H2,1H3,(H,26,27)(H,34,35)(H2,31,32,33)/t10-,15+,17+,18+,21+/m0/s1 |
| InChIKey | HBHZJWHWNPWQBC-YUFWMBRBSA-N |
| XLogP | 2.22 |
| TPSA | 220.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|