C20H24ClFN4O9P2 — CID 130424050
[[(2R,3S,4R,5R)-5-[2-chloro-4-[[(1S)-1-(3-fluorophenyl)ethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 130424050) has the molecular formula C20H24ClFN4O9P2 and a molecular weight of 580.83 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[2-chloro-4-[[(1S)-1-(3-fluorophenyl)ethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[2-chloro-4-[[(1S)-1-(3-fluorophenyl)ethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 130424050 |
| Molecular Formula | C20H24ClFN4O9P2 |
| Molecular Weight | 580.83 g/mol |
| Exact Mass | 580.07 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[2-chloro-4-[[(1S)-1-(3-fluorophenyl)ethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@H](Nc1nc(Cl)nc2c1ccn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1cccc(F)c1 |
| InChI | InChI=1S/C20H24ClFN4O9P2/c1-10(11-3-2-4-12(22)7-11)23-17-13-5-6-26(18(13)25-20(21)24-17)19-16(28)15(27)14(35-19)8-34-37(32,33)9-36(29,30)31/h2-7,10,14-16,19,27-28H,8-9H2,1H3,(H,32,33)(H,23,24,25)(H2,29,30,31)/t10-,14+,15+,16+,19+/m0/s1 |
| InChIKey | MWFRGJZEWIWENB-ZBFVOTQZSA-N |
| XLogP | 2.35 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.83 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|