C21H26ClFN4O9P2 — CID 155657036
[[(2R,3S,4R,5R)-5-[2-chloro-4-[[(2S)-1-(2-fluorophenyl)propan-2-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155657036) has the molecular formula C21H26ClFN4O9P2 and a molecular weight of 594.86 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[2-chloro-4-[[(2S)-1-(2-fluorophenyl)propan-2-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[2-chloro-4-[[(2S)-1-(2-fluorophenyl)propan-2-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155657036 |
| Molecular Formula | C21H26ClFN4O9P2 |
| Molecular Weight | 594.86 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[2-chloro-4-[[(2S)-1-(2-fluorophenyl)propan-2-yl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C[C@@H](Cc1ccccc1F)Nc1nc(Cl)nc2c1ccn2[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H26ClFN4O9P2/c1-11(8-12-4-2-3-5-14(12)23)24-18-13-6-7-27(19(13)26-21(22)25-18)20-17(29)16(28)15(36-20)9-35-38(33,34)10-37(30,31)32/h2-7,11,15-17,20,28-29H,8-10H2,1H3,(H,33,34)(H,24,25,26)(H2,30,31,32)/t11-,15+,16+,17+,20+/m0/s1 |
| InChIKey | QHMLOBDPSSNAMF-WMKSTLHKSA-N |
| XLogP | 2.22 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.86 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|