C18H22ClN5O9P2 — CID 130205976
[[(2R,3S,4R,5R)-5-[4-(benzylamino)-6-chloropyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 130205976) has the molecular formula C18H22ClN5O9P2 and a molecular weight of 549.80 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[4-(benzylamino)-6-chloropyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[4-(benzylamino)-6-chloropyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 130205976 |
| Molecular Formula | C18H22ClN5O9P2 |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[4-(benzylamino)-6-chloropyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2ncc3c(NCc4ccccc4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H22ClN5O9P2/c19-18-22-15(20-6-10-4-2-1-3-5-10)11-7-21-24(16(11)23-18)17-14(26)13(25)12(33-17)8-32-35(30,31)9-34(27,28)29/h1-5,7,12-14,17,25-26H,6,8-9H2,(H,30,31)(H,20,22,23)(H2,27,28,29)/t12-,13-,14-,17-/m1/s1 |
| InChIKey | WSMAWKQTHDXPAT-VMUDFCTBSA-N |
| XLogP | 1.05 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|