C15H21ClN6O9P2 — CID 170782235
[[(2R,3S,4R,5R)-5-[6-chloro-4-[(2E)-2-(cyclopropylmethylidene)hydrazinyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 170782235) has the molecular formula C15H21ClN6O9P2 and a molecular weight of 526.77 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-chloro-4-[(2E)-2-(cyclopropylmethylidene)hydrazinyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[(2E)-2-(cyclopropylmethylidene)hydrazinyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 170782235 |
| Molecular Formula | C15H21ClN6O9P2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[(2E)-2-(cyclopropylmethylidene)hydrazinyl]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2ncc3c(N/N=C/C4CC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21ClN6O9P2/c16-15-19-12(21-17-3-7-1-2-7)8-4-18-22(13(8)20-15)14-11(24)10(23)9(31-14)5-30-33(28,29)6-32(25,26)27/h3-4,7,9-11,14,23-24H,1-2,5-6H2,(H,28,29)(H,19,20,21)(H2,25,26,27)/b17-3+/t9-,10-,11-,14-/m1/s1 |
| InChIKey | MGKOPVBQWRYMIK-PLLMJTPDSA-N |
| XLogP | 0.24 |
| TPSA | 221.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|